About [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate
[4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate (PubChem CID 87308337) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate.
Molecular Properties
| Compound Name | [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate |
| PubChem CID | 87308337 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate |
| SMILES | CC1(C)C(=O)N(C2C3CC4CC2CC(OC=O)(C4)C3)C1C1(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-22(2)20(24(6-7-24)18-5-3-4-8-25-18)26(21(22)28)19-16-9-15-10-17(19)13-23(11-15,12-16)29-14-27/h3-5,8,14-17,19-20H,6-7,9-13H2,1-2H3 |
| InChIKey | ZEPOBZYHMMCUNV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate?
The IUPAC name of [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate (CID 87308337) is [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate.
What is the SMILES notation for [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate?
The canonical SMILES for [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate is CC1(C)C(=O)N(C2C3CC4CC2CC(OC=O)(C4)C3)C1C1(c2ccccn2)CC1.
What is the InChIKey of [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate?
The InChIKey is ZEPOBZYHMMCUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-22(2)20(24(6-7-24)18-5-3-4-8-25-18)26(21(22)28)19-16-9-15-10-17(19)13-23(11-15,12-16)29-14-27/h3-5,8,14-17,19-20H,6-7,9-13H2,1-2H3.
What are the key properties of [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate?
[4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate has a molecular weight of 394.52 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,3-dimethyl-2-oxo-4-(1-pyridin-2-ylcyclopropyl)azetidin-1-yl]-1-adamantyl] formate is sourced from PubChem (CID 87308337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).