About (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid
(4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid (PubChem CID 87308438) has the molecular formula C16H17ClN4O2
and a molecular weight of 332.79 g/mol. Its IUPAC name is (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid.
Molecular Properties
| Compound Name | (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid |
| PubChem CID | 87308438 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid |
| SMILES | CCCCCN(C(=O)O)c1n[nH]c2c(Cl)nc3ccccc3c12 |
| InChI | InChI=1S/C16H17ClN4O2/c1-2-3-6-9-21(16(22)23)15-12-10-7-4-5-8-11(10)18-14(17)13(12)19-20-15/h4-5,7-8H,2-3,6,9H2,1H3,(H,19,20)(H,22,23) |
| InChIKey | RHPZAQWHEBESKK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid?
The IUPAC name of (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid (CID 87308438) is (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid.
What is the SMILES notation for (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid?
The canonical SMILES for (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid is CCCCCN(C(=O)O)c1n[nH]c2c(Cl)nc3ccccc3c12.
What is the InChIKey of (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid?
The InChIKey is RHPZAQWHEBESKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN4O2/c1-2-3-6-9-21(16(22)23)15-12-10-7-4-5-8-11(10)18-14(17)13(12)19-20-15/h4-5,7-8H,2-3,6,9H2,1H3,(H,19,20)(H,22,23).
What are the key properties of (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid?
(4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid has a molecular weight of 332.79 g/mol, XLogP of 4.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3H-pyrazolo[5,4-c]quinolin-1-yl)-pentylcarbamic acid is sourced from PubChem (CID 87308438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).