About 2H-acridin-1-one;10H-benzo[a]anthracen-9-one
2H-acridin-1-one;10H-benzo[a]anthracen-9-one (PubChem CID 87308673) has the molecular formula C31H21NO2
and a molecular weight of 439.51 g/mol. Its IUPAC name is 2H-acridin-1-one;10H-benzo[a]anthracen-9-one.
Molecular Properties
| Compound Name | 2H-acridin-1-one;10H-benzo[a]anthracen-9-one |
| PubChem CID | 87308673 |
| Molecular Formula | C31H21NO2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2H-acridin-1-one;10H-benzo[a]anthracen-9-one |
| SMILES | O=C1C=c2cc3ccc4ccccc4c3cc2=CC1.O=C1CC=Cc2nc3ccccc3cc21 |
| InChI | InChI=1S/C18H12O.C13H9NO/c19-16-8-7-13-11-18-14(9-15(13)10-16)6-5-12-3-1-2-4-17(12)18;15-13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)14-12/h1-7,9-11H,8H2;1-6,8H,7H2 |
| InChIKey | ARIOOIANQGGEPE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2H-acridin-1-one;10H-benzo[a]anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-acridin-1-one;10H-benzo[a]anthracen-9-one?
The IUPAC name of 2H-acridin-1-one;10H-benzo[a]anthracen-9-one (CID 87308673) is 2H-acridin-1-one;10H-benzo[a]anthracen-9-one.
What is the SMILES notation for 2H-acridin-1-one;10H-benzo[a]anthracen-9-one?
The canonical SMILES for 2H-acridin-1-one;10H-benzo[a]anthracen-9-one is O=C1C=c2cc3ccc4ccccc4c3cc2=CC1.O=C1CC=Cc2nc3ccccc3cc21.
What is the InChIKey of 2H-acridin-1-one;10H-benzo[a]anthracen-9-one?
The InChIKey is ARIOOIANQGGEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O.C13H9NO/c19-16-8-7-13-11-18-14(9-15(13)10-16)6-5-12-3-1-2-4-17(12)18;15-13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)14-12/h1-7,9-11H,8H2;1-6,8H,7H2.
What are the key properties of 2H-acridin-1-one;10H-benzo[a]anthracen-9-one?
2H-acridin-1-one;10H-benzo[a]anthracen-9-one has a molecular weight of 439.51 g/mol, XLogP of 5.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-acridin-1-one;10H-benzo[a]anthracen-9-one is sourced from PubChem (CID 87308673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).