C29H32O2 — CID 87308864
2-(4-ethenylphenyl)ethanol;2-[(4-ethenylphenyl)methyl]oxirane;styrene (PubChem CID 87308864) has the molecular formula C29H32O2 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)ethanol;2-[(4-ethenylphenyl)methyl]oxirane;styrene.
| Compound Name | 2-(4-ethenylphenyl)ethanol;2-[(4-ethenylphenyl)methyl]oxirane;styrene |
|---|---|
| PubChem CID | 87308864 |
| Molecular Formula | C29H32O2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-(4-ethenylphenyl)ethanol;2-[(4-ethenylphenyl)methyl]oxirane;styrene |
| SMILES | C=Cc1ccc(CC2CO2)cc1.C=Cc1ccc(CCO)cc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C11H12O.C10H12O.C8H8/c1-2-9-3-5-10(6-4-9)7-11-8-12-11;1-2-9-3-5-10(6-4-9)7-8-11;1-2-8-6-4-3-5-7-8/h2-6,11H,1,7-8H2;2-6,11H,1,7-8H2;2-7H,1H2 |
| InChIKey | LKYGHEXXDXCLQF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|