About bis(1,3,3,3-tetrafluoropropyl) carbonate
bis(1,3,3,3-tetrafluoropropyl) carbonate (PubChem CID 87308878) has the molecular formula C7H6F8O3
and a molecular weight of 290.11 g/mol. Its IUPAC name is bis(1,3,3,3-tetrafluoropropyl) carbonate.
Molecular Properties
| Compound Name | bis(1,3,3,3-tetrafluoropropyl) carbonate |
| PubChem CID | 87308878 |
| Molecular Formula | C7H6F8O3 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | bis(1,3,3,3-tetrafluoropropyl) carbonate |
| SMILES | O=C(OC(F)CC(F)(F)F)OC(F)CC(F)(F)F |
| InChI | InChI=1S/C7H6F8O3/c8-3(1-6(10,11)12)17-5(16)18-4(9)2-7(13,14)15/h3-4H,1-2H2 |
| InChIKey | WSHQNEUBYUWAAQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(1,3,3,3-tetrafluoropropyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3,3,3-tetrafluoropropyl) carbonate?
The IUPAC name of bis(1,3,3,3-tetrafluoropropyl) carbonate (CID 87308878) is bis(1,3,3,3-tetrafluoropropyl) carbonate.
What is the SMILES notation for bis(1,3,3,3-tetrafluoropropyl) carbonate?
The canonical SMILES for bis(1,3,3,3-tetrafluoropropyl) carbonate is O=C(OC(F)CC(F)(F)F)OC(F)CC(F)(F)F.
What is the InChIKey of bis(1,3,3,3-tetrafluoropropyl) carbonate?
The InChIKey is WSHQNEUBYUWAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F8O3/c8-3(1-6(10,11)12)17-5(16)18-4(9)2-7(13,14)15/h3-4H,1-2H2.
What are the key properties of bis(1,3,3,3-tetrafluoropropyl) carbonate?
bis(1,3,3,3-tetrafluoropropyl) carbonate has a molecular weight of 290.11 g/mol, XLogP of 3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3,3,3-tetrafluoropropyl) carbonate is sourced from PubChem (CID 87308878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).