About acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride
acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride (PubChem CID 87308906) has the molecular formula C13H15Cl2N5O
and a molecular weight of 328.20 g/mol. Its IUPAC name is acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride.
Molecular Properties
| Compound Name | acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride |
| PubChem CID | 87308906 |
| Molecular Formula | C13H15Cl2N5O |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride |
| SMILES | CC(=O)Cl.Cl.Nc1ccc(/N=N/c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C11H11N5.C2H3ClO.ClH/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;1-2(3)4;/h1-7H,(H4,12,13,14);1H3;1H/b16-15+;; |
| InChIKey | CMWOPOAEFRYMSC-VRZXRVJBSA-N |
| XLogP | 3.85 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride?
The IUPAC name of acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride (CID 87308906) is acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride.
What is the SMILES notation for acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride?
The canonical SMILES for acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride is CC(=O)Cl.Cl.Nc1ccc(/N=N/c2ccccc2)c(N)n1.
What is the InChIKey of acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride?
The InChIKey is CMWOPOAEFRYMSC-VRZXRVJBSA-N. The full InChI is InChI=1S/C11H11N5.C2H3ClO.ClH/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;1-2(3)4;/h1-7H,(H4,12,13,14);1H3;1H/b16-15+;;.
What are the key properties of acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride?
acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride has a molecular weight of 328.20 g/mol, XLogP of 3.85, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl chloride;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride is sourced from PubChem (CID 87308906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).