C12H9N3O3S3 — CID 87309133
2-[(5E)-5-(6,7-dihydrothieno[2,3-b]pyrazin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 87309133) has the molecular formula C12H9N3O3S3 and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[(5E)-5-(6,7-dihydrothieno[2,3-b]pyrazin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-(6,7-dihydrothieno[2,3-b]pyrazin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 87309133 |
| Molecular Formula | C12H9N3O3S3 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 2-[(5E)-5-(6,7-dihydrothieno[2,3-b]pyrazin-6-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C\C2Cc3nccnc3S2)SC1=S |
| InChI | InChI=1S/C12H9N3O3S3/c16-9(17)5-15-11(18)8(21-12(15)19)4-6-3-7-10(20-6)14-2-1-13-7/h1-2,4,6H,3,5H2,(H,16,17)/b8-4+ |
| InChIKey | DJXFPOXVENPJBF-XBXARRHUSA-N |
| XLogP | 1.32 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|