About dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane
dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane (PubChem CID 87309177) has the molecular formula C23H39FP2
and a molecular weight of 396.51 g/mol. Its IUPAC name is dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane.
Molecular Properties
| Compound Name | dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane |
| PubChem CID | 87309177 |
| Molecular Formula | C23H39FP2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane |
| SMILES | CCCC(F)PC(C)C1C=CC=C1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H39FP2/c1-3-11-23(24)25-18(2)21-16-10-17-22(21)26(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h10,16-21,23,25H,3-9,11-15H2,1-2H3 |
| InChIKey | BCPMOKDMQYNBSM-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane?
The IUPAC name of dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane (CID 87309177) is dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane.
What is the SMILES notation for dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane?
The canonical SMILES for dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane is CCCC(F)PC(C)C1C=CC=C1P(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane?
The InChIKey is BCPMOKDMQYNBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H39FP2/c1-3-11-23(24)25-18(2)21-16-10-17-22(21)26(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h10,16-21,23,25H,3-9,11-15H2,1-2H3.
What are the key properties of dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane?
dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane has a molecular weight of 396.51 g/mol, XLogP of 8.37, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl-[5-[1-(1-fluorobutylphosphanyl)ethyl]cyclopenta-1,3-dien-1-yl]phosphane is sourced from PubChem (CID 87309177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).