About 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride
5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 87309190) has the molecular formula C4H9Cl2N3S
and a molecular weight of 202.11 g/mol. Its IUPAC name is 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride |
| PubChem CID | 87309190 |
| Molecular Formula | C4H9Cl2N3S |
| Molecular Weight | 202.11 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cnc(N)s1 |
| InChI | InChI=1S/C4H7N3S.2ClH/c5-1-3-2-7-4(6)8-3;;/h2H,1,5H2,(H2,6,7);2*1H |
| InChIKey | FSEPTCYRDLILPI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.11 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride?
The IUPAC name of 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride (CID 87309190) is 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride.
What is the SMILES notation for 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride?
The canonical SMILES for 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride is Cl.Cl.NCc1cnc(N)s1.
What is the InChIKey of 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride?
The InChIKey is FSEPTCYRDLILPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S.2ClH/c5-1-3-2-7-4(6)8-3;;/h2H,1,5H2,(H2,6,7);2*1H.
What are the key properties of 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride?
5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride has a molecular weight of 202.11 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1,3-thiazol-2-amine;dihydrochloride is sourced from PubChem (CID 87309190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).