C12H7BF21N3 — CID 87309263
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1H-1,2,4-triazol-4-ium tetrafluoroborate (PubChem CID 87309263) has the molecular formula C12H7BF21N3 and a molecular weight of 602.98 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1H-1,2,4-triazol-4-ium tetrafluoroborate.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1H-1,2,4-triazol-4-ium tetrafluoroborate |
|---|---|
| PubChem CID | 87309263 |
| Molecular Formula | C12H7BF21N3 |
| Molecular Weight | 602.98 g/mol |
| Exact Mass | 603.04 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1H-1,2,4-triazol-4-ium tetrafluoroborate |
| SMILES | Cc1[nH]nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[n+]1C.F[B-](F)(F)F |
| InChI | InChI=1S/C12H6F17N3.BF4/c1-3-30-31-4(32(3)2)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29;2-1(3,4)5/h1-2H3;/q;-1/p+1 |
| InChIKey | INPKHWLTCSJXNO-UHFFFAOYSA-O |
| XLogP | 6.31 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.98 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|