C18H23F2N5O2 — CID 87310145
5-amino-N-[5-[[[1-amino-2-(2-fluoroethoxy)ethylidene]amino]methyl]-4-fluorocyclohexa-1,3-dien-1-yl]-3-methylpyridine-2-carboxamide (PubChem CID 87310145) has the molecular formula C18H23F2N5O2 and a molecular weight of 379.41 g/mol. Its IUPAC name is 5-amino-N-[5-[[[1-amino-2-(2-fluoroethoxy)ethylidene]amino]methyl]-4-fluorocyclohexa-1,3-dien-1-yl]-3-methylpyridine-2-carboxamide.
| Compound Name | 5-amino-N-[5-[[[1-amino-2-(2-fluoroethoxy)ethylidene]amino]methyl]-4-fluorocyclohexa-1,3-dien-1-yl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 87310145 |
| Molecular Formula | C18H23F2N5O2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-amino-N-[5-[[[1-amino-2-(2-fluoroethoxy)ethylidene]amino]methyl]-4-fluorocyclohexa-1,3-dien-1-yl]-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(N)cnc1C(=O)NC1=CC=C(F)C(C/N=C(/N)COCCF)C1 |
| InChI | InChI=1S/C18H23F2N5O2/c1-11-6-13(21)9-24-17(11)18(26)25-14-2-3-15(20)12(7-14)8-23-16(22)10-27-5-4-19/h2-3,6,9,12H,4-5,7-8,10,21H2,1H3,(H2,22,23)(H,25,26) |
| InChIKey | ALBCLBCPFJKTTP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|