C18H24N6O2S — CID 87310677
(5E)-5-[[2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87310677) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is (5E)-5-[[2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87310677 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (5E)-5-[[2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(C2CCN(c3nccc(/C=C4/SC(=O)NC4=O)n3)CC2)CC1 |
| InChI | InChI=1S/C18H24N6O2S/c1-22-8-10-23(11-9-22)14-3-6-24(7-4-14)17-19-5-2-13(20-17)12-15-16(25)21-18(26)27-15/h2,5,12,14H,3-4,6-11H2,1H3,(H,21,25,26)/b15-12+ |
| InChIKey | SWNISYWGABRKGB-NTCAYCPXSA-N |
| XLogP | 1.02 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|