C17H22N4O — CID 87311391
1-cyano-1-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)urea (PubChem CID 87311391) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-cyano-1-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)urea.
| Compound Name | 1-cyano-1-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)urea |
|---|---|
| PubChem CID | 87311391 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-cyano-1-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)urea |
| SMILES | N#CN(C(N)=O)c1ccc2c(c1)CCC(N1CCCC1)CC2 |
| InChI | InChI=1S/C17H22N4O/c18-12-21(17(19)22)16-8-4-13-3-6-15(7-5-14(13)11-16)20-9-1-2-10-20/h4,8,11,15H,1-3,5-7,9-10H2,(H2,19,22) |
| InChIKey | AGFIXBNYTMPRDH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|