C6H10O5S — CID 87311512
(3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanethial (PubChem CID 87311512) has the molecular formula C6H10O5S and a molecular weight of 194.21 g/mol. Its IUPAC name is (3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanethial.
| Compound Name | (3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanethial |
|---|---|
| PubChem CID | 87311512 |
| Molecular Formula | C6H10O5S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanethial |
| SMILES | O=C(C=S)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H10O5S/c7-1-3(8)5(10)6(11)4(9)2-12/h2-3,5-8,10-11H,1H2/t3-,5-,6+/m1/s1 |
| InChIKey | XBXUFPMEVZDXFZ-PUFIMZNGSA-N |
| XLogP | -2.37 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|