About lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide
lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide (PubChem CID 87312148) has the molecular formula C14H24LiN
and a molecular weight of 213.29 g/mol. Its IUPAC name is lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide.
Molecular Properties
| Compound Name | lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide |
| PubChem CID | 87312148 |
| Molecular Formula | C14H24LiN |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide |
| SMILES | CCC(C)(C)c1[c-]cc(C(C)(C)CC)[nH]1.[Li+] |
| InChI | InChI=1S/C14H24N.Li/c1-7-13(3,4)11-9-10-12(15-11)14(5,6)8-2;/h9,15H,7-8H2,1-6H3;/q-1;+1 |
| InChIKey | IIIYNLWLIPSSBQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide?
The IUPAC name of lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide (CID 87312148) is lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide.
What is the SMILES notation for lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide?
The canonical SMILES for lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide is CCC(C)(C)c1[c-]cc(C(C)(C)CC)[nH]1.[Li+].
What is the InChIKey of lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide?
The InChIKey is IIIYNLWLIPSSBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N.Li/c1-7-13(3,4)11-9-10-12(15-11)14(5,6)8-2;/h9,15H,7-8H2,1-6H3;/q-1;+1.
What are the key properties of lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide?
lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide has a molecular weight of 213.29 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2,5-bis(2-methylbutan-2-yl)-1,3-dihydropyrrol-3-ide is sourced from PubChem (CID 87312148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).