About butane-2,3-dione;ethane-1,2-diol
butane-2,3-dione;ethane-1,2-diol (PubChem CID 87312278) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is butane-2,3-dione;ethane-1,2-diol.
Molecular Properties
| Compound Name | butane-2,3-dione;ethane-1,2-diol |
| PubChem CID | 87312278 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | butane-2,3-dione;ethane-1,2-diol |
| SMILES | CC(=O)C(C)=O.OCCO |
| InChI | InChI=1S/C4H6O2.C2H6O2/c1-3(5)4(2)6;3-1-2-4/h1-2H3;3-4H,1-2H2 |
| InChIKey | KIOOYBFMWDJJBT-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze butane-2,3-dione;ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-dione;ethane-1,2-diol?
The IUPAC name of butane-2,3-dione;ethane-1,2-diol (CID 87312278) is butane-2,3-dione;ethane-1,2-diol.
What is the SMILES notation for butane-2,3-dione;ethane-1,2-diol?
The canonical SMILES for butane-2,3-dione;ethane-1,2-diol is CC(=O)C(C)=O.OCCO.
What is the InChIKey of butane-2,3-dione;ethane-1,2-diol?
The InChIKey is KIOOYBFMWDJJBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H6O2/c1-3(5)4(2)6;3-1-2-4/h1-2H3;3-4H,1-2H2.
What are the key properties of butane-2,3-dione;ethane-1,2-diol?
butane-2,3-dione;ethane-1,2-diol has a molecular weight of 148.16 g/mol, XLogP of -0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-dione;ethane-1,2-diol is sourced from PubChem (CID 87312278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).