About 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione
3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 87312576) has the molecular formula C16H19ClN4O2
and a molecular weight of 334.81 g/mol. Its IUPAC name is 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione |
| PubChem CID | 87312576 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(Nc2ccnc(Cl)n2)c(=O)c1=O)C1CCCCC1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-9(10-5-3-2-4-6-10)19-12-13(15(23)14(12)22)20-11-7-8-18-16(17)21-11/h7-10,19H,2-6H2,1H3,(H,18,20,21)/t9-/m1/s1 |
| InChIKey | YYFOPRJPLWVNMW-SECBINFHSA-N |
| XLogP | 2.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione (CID 87312576) is 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione is C[C@@H](Nc1c(Nc2ccnc(Cl)n2)c(=O)c1=O)C1CCCCC1.
What is the InChIKey of 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione?
The InChIKey is YYFOPRJPLWVNMW-SECBINFHSA-N. The full InChI is InChI=1S/C16H19ClN4O2/c1-9(10-5-3-2-4-6-10)19-12-13(15(23)14(12)22)20-11-7-8-18-16(17)21-11/h7-10,19H,2-6H2,1H3,(H,18,20,21)/t9-/m1/s1.
What are the key properties of 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione?
3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione has a molecular weight of 334.81 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloropyrimidin-4-yl)amino]-4-[[(1R)-1-cyclohexylethyl]amino]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 87312576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).