About tris(diethylazanide);di(propan-2-yl)azanide;tungsten
tris(diethylazanide);di(propan-2-yl)azanide;tungsten (PubChem CID 87312600) has the molecular formula C18H44N4W-4
and a molecular weight of 500.42 g/mol. Its IUPAC name is tris(diethylazanide);di(propan-2-yl)azanide;tungsten.
Molecular Properties
| Compound Name | tris(diethylazanide);di(propan-2-yl)azanide;tungsten |
| PubChem CID | 87312600 |
| Molecular Formula | C18H44N4W-4 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | tris(diethylazanide);di(propan-2-yl)azanide;tungsten |
| SMILES | CC(C)[N-]C(C)C.CC[N-]CC.CC[N-]CC.CC[N-]CC.[W] |
| InChI | InChI=1S/C6H14N.3C4H10N.W/c1-5(2)7-6(3)4;3*1-3-5-4-2;/h5-6H,1-4H3;3*3-4H2,1-2H3;/q4*-1; |
| InChIKey | ZZQQIRJYJPUOTB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tris(diethylazanide);di(propan-2-yl)azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(diethylazanide);di(propan-2-yl)azanide;tungsten?
The IUPAC name of tris(diethylazanide);di(propan-2-yl)azanide;tungsten (CID 87312600) is tris(diethylazanide);di(propan-2-yl)azanide;tungsten.
What is the SMILES notation for tris(diethylazanide);di(propan-2-yl)azanide;tungsten?
The canonical SMILES for tris(diethylazanide);di(propan-2-yl)azanide;tungsten is CC(C)[N-]C(C)C.CC[N-]CC.CC[N-]CC.CC[N-]CC.[W].
What is the InChIKey of tris(diethylazanide);di(propan-2-yl)azanide;tungsten?
The InChIKey is ZZQQIRJYJPUOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N.3C4H10N.W/c1-5(2)7-6(3)4;3*1-3-5-4-2;/h5-6H,1-4H3;3*3-4H2,1-2H3;/q4*-1;.
What are the key properties of tris(diethylazanide);di(propan-2-yl)azanide;tungsten?
tris(diethylazanide);di(propan-2-yl)azanide;tungsten has a molecular weight of 500.42 g/mol, XLogP of 6.37, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(diethylazanide);di(propan-2-yl)azanide;tungsten is sourced from PubChem (CID 87312600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).