About azane;propan-2-yl N-propan-2-ylcarbamate
azane;propan-2-yl N-propan-2-ylcarbamate (PubChem CID 87313136) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is azane;propan-2-yl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | azane;propan-2-yl N-propan-2-ylcarbamate |
| PubChem CID | 87313136 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | azane;propan-2-yl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC(C)C.N |
| InChI | InChI=1S/C7H15NO2.H3N/c1-5(2)8-7(9)10-6(3)4;/h5-6H,1-4H3,(H,8,9);1H3 |
| InChIKey | CCHDYCVLCZIBFZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;propan-2-yl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propan-2-yl N-propan-2-ylcarbamate?
The IUPAC name of azane;propan-2-yl N-propan-2-ylcarbamate (CID 87313136) is azane;propan-2-yl N-propan-2-ylcarbamate.
What is the SMILES notation for azane;propan-2-yl N-propan-2-ylcarbamate?
The canonical SMILES for azane;propan-2-yl N-propan-2-ylcarbamate is CC(C)NC(=O)OC(C)C.N.
What is the InChIKey of azane;propan-2-yl N-propan-2-ylcarbamate?
The InChIKey is CCHDYCVLCZIBFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.H3N/c1-5(2)8-7(9)10-6(3)4;/h5-6H,1-4H3,(H,8,9);1H3.
What are the key properties of azane;propan-2-yl N-propan-2-ylcarbamate?
azane;propan-2-yl N-propan-2-ylcarbamate has a molecular weight of 162.23 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propan-2-yl N-propan-2-ylcarbamate is sourced from PubChem (CID 87313136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).