C11H23FNO3P — CID 87313561
ethoxy-fluoro-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphane (PubChem CID 87313561) has the molecular formula C11H23FNO3P and a molecular weight of 267.28 g/mol. Its IUPAC name is ethoxy-fluoro-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphane.
| Compound Name | ethoxy-fluoro-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphane |
|---|---|
| PubChem CID | 87313561 |
| Molecular Formula | C11H23FNO3P |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | ethoxy-fluoro-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyphosphane |
| SMILES | CCOP(F)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C11H23FNO3P/c1-6-15-17(12)16-9-7-10(2,3)13(14)11(4,5)8-9/h9,14H,6-8H2,1-5H3 |
| InChIKey | DENBEBDOAFPBAR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|