C35H37N5O3S — CID 87313659
2-[4-(dibenzylamino)-2-methylcyclopentyl]-2-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]acetaldehyde (PubChem CID 87313659) has the molecular formula C35H37N5O3S and a molecular weight of 607.78 g/mol. Its IUPAC name is 2-[4-(dibenzylamino)-2-methylcyclopentyl]-2-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]acetaldehyde.
| Compound Name | 2-[4-(dibenzylamino)-2-methylcyclopentyl]-2-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]acetaldehyde |
|---|---|
| PubChem CID | 87313659 |
| Molecular Formula | C35H37N5O3S |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | 2-[4-(dibenzylamino)-2-methylcyclopentyl]-2-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(NC(C=O)C4CC(N(Cc5ccccc5)Cc5ccccc5)CC4C)cnc32)cc1 |
| InChI | InChI=1S/C35H37N5O3S/c1-25-13-15-30(16-14-25)44(42,43)40-18-17-32-35(40)36-21-34(37-32)38-33(24-41)31-20-29(19-26(31)2)39(22-27-9-5-3-6-10-27)23-28-11-7-4-8-12-28/h3-18,21,24,26,29,31,33H,19-20,22-23H2,1-2H3,(H,37,38) |
| InChIKey | ZTRXMEDGXCTZGN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|