C10H11F5N2O3S — CID 87313890
N-[3-amino-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]methanesulfonamide (PubChem CID 87313890) has the molecular formula C10H11F5N2O3S and a molecular weight of 334.27 g/mol. Its IUPAC name is N-[3-amino-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]methanesulfonamide.
| Compound Name | N-[3-amino-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 87313890 |
| Molecular Formula | C10H11F5N2O3S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-[3-amino-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]methanesulfonamide |
| SMILES | COc1c(N)cc(C(F)(F)C(F)(F)F)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C10H11F5N2O3S/c1-20-8-6(16)3-5(9(11,12)10(13,14)15)4-7(8)17-21(2,18)19/h3-4,17H,16H2,1-2H3 |
| InChIKey | QBSDQEWLUCOFPG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|