C34H39F5N4O8S — CID 87313917
tert-butyl [4-[[4-[5-[[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]-2-methylphenoxy]-2-pyridinyl]methyl]piperidin-1-yl] carbonate (PubChem CID 87313917) has the molecular formula C34H39F5N4O8S and a molecular weight of 758.76 g/mol. Its IUPAC name is tert-butyl [4-[[4-[5-[[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]-2-methylphenoxy]-2-pyridinyl]methyl]piperidin-1-yl] carbonate.
| Compound Name | tert-butyl [4-[[4-[5-[[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]-2-methylphenoxy]-2-pyridinyl]methyl]piperidin-1-yl] carbonate |
|---|---|
| PubChem CID | 87313917 |
| Molecular Formula | C34H39F5N4O8S |
| Molecular Weight | 758.76 g/mol |
| Exact Mass | 758.24 |
| IUPAC Name | tert-butyl [4-[[4-[5-[[3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]-2-methylphenoxy]-2-pyridinyl]methyl]piperidin-1-yl] carbonate |
| SMILES | COc1c(NC(=O)c2ccc(C)c(Oc3ccnc(CC4CCN(OC(=O)OC(C)(C)C)CC4)c3)c2)cc(C(F)(F)C(F)(F)F)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C34H39F5N4O8S/c1-20-7-8-22(30(44)41-26-17-23(33(35,36)34(37,38)39)18-27(29(26)48-5)42-52(6,46)47)16-28(20)49-25-9-12-40-24(19-25)15-21-10-13-43(14-11-21)51-31(45)50-32(2,3)4/h7-9,12,16-19,21,42H,10-11,13-15H2,1-6H3,(H,41,44) |
| InChIKey | DODAVDZAOXFRLA-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.76 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|