C19H22N4O2S — CID 8731392
(3S)-1-[2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetyl]piperidine-3-carboxamide (PubChem CID 8731392) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is (3S)-1-[2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 8731392 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (3S)-1-[2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(-c2ccccc2)nc(SCC(=O)N2CCC[C@H](C(N)=O)C2)n1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13-10-16(14-6-3-2-4-7-14)22-19(21-13)26-12-17(24)23-9-5-8-15(11-23)18(20)25/h2-4,6-7,10,15H,5,8-9,11-12H2,1H3,(H2,20,25)/t15-/m0/s1 |
| InChIKey | YGKJUNZKYJWNND-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |