About [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate
[2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate (PubChem CID 87313968) has the molecular formula C10H8F3N3O4S
and a molecular weight of 323.25 g/mol. Its IUPAC name is [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate |
| PubChem CID | 87313968 |
| Molecular Formula | C10H8F3N3O4S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate |
| SMILES | CNC(=O)c1cc2cc(OS(=O)(=O)C(F)(F)F)ccn2n1 |
| InChI | InChI=1S/C10H8F3N3O4S/c1-14-9(17)8-5-6-4-7(2-3-16(6)15-8)20-21(18,19)10(11,12)13/h2-5H,1H3,(H,14,17) |
| InChIKey | MERKANYZMAPLDR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate?
The IUPAC name of [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate (CID 87313968) is [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate.
What is the SMILES notation for [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate?
The canonical SMILES for [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate is CNC(=O)c1cc2cc(OS(=O)(=O)C(F)(F)F)ccn2n1.
What is the InChIKey of [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate?
The InChIKey is MERKANYZMAPLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3O4S/c1-14-9(17)8-5-6-4-7(2-3-16(6)15-8)20-21(18,19)10(11,12)13/h2-5H,1H3,(H,14,17).
What are the key properties of [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate?
[2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate has a molecular weight of 323.25 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylcarbamoyl)pyrazolo[1,5-a]pyridin-5-yl] trifluoromethanesulfonate is sourced from PubChem (CID 87313968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).