About 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane
1-methoxy-2,4-dimethyl-3-methylsulfanylpentane (PubChem CID 87313981) has the molecular formula C9H20OS
and a molecular weight of 176.32 g/mol. Its IUPAC name is 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane.
Molecular Properties
| Compound Name | 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane |
| PubChem CID | 87313981 |
| Molecular Formula | C9H20OS |
| Molecular Weight | 176.32 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane |
| SMILES | COCC(C)C(SC)C(C)C |
| InChI | InChI=1S/C9H20OS/c1-7(2)9(11-5)8(3)6-10-4/h7-9H,6H2,1-5H3 |
| InChIKey | FAIAKQRTUSPVRO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane?
The IUPAC name of 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane (CID 87313981) is 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane.
What is the SMILES notation for 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane?
The canonical SMILES for 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane is COCC(C)C(SC)C(C)C.
What is the InChIKey of 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane?
The InChIKey is FAIAKQRTUSPVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20OS/c1-7(2)9(11-5)8(3)6-10-4/h7-9H,6H2,1-5H3.
What are the key properties of 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane?
1-methoxy-2,4-dimethyl-3-methylsulfanylpentane has a molecular weight of 176.32 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,4-dimethyl-3-methylsulfanylpentane is sourced from PubChem (CID 87313981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).