About 1-fluoroprop-2-enyl carbonochloridate
1-fluoroprop-2-enyl carbonochloridate (PubChem CID 87314349) has the molecular formula C4H4ClFO2
and a molecular weight of 138.52 g/mol. Its IUPAC name is 1-fluoroprop-2-enyl carbonochloridate.
Molecular Properties
| Compound Name | 1-fluoroprop-2-enyl carbonochloridate |
| PubChem CID | 87314349 |
| Molecular Formula | C4H4ClFO2 |
| Molecular Weight | 138.52 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | 1-fluoroprop-2-enyl carbonochloridate |
| SMILES | C=CC(F)OC(=O)Cl |
| InChI | InChI=1S/C4H4ClFO2/c1-2-3(6)8-4(5)7/h2-3H,1H2 |
| InChIKey | YXSGEUHBTZXMPT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroprop-2-enyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroprop-2-enyl carbonochloridate?
The IUPAC name of 1-fluoroprop-2-enyl carbonochloridate (CID 87314349) is 1-fluoroprop-2-enyl carbonochloridate.
What is the SMILES notation for 1-fluoroprop-2-enyl carbonochloridate?
The canonical SMILES for 1-fluoroprop-2-enyl carbonochloridate is C=CC(F)OC(=O)Cl.
What is the InChIKey of 1-fluoroprop-2-enyl carbonochloridate?
The InChIKey is YXSGEUHBTZXMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClFO2/c1-2-3(6)8-4(5)7/h2-3H,1H2.
What are the key properties of 1-fluoroprop-2-enyl carbonochloridate?
1-fluoroprop-2-enyl carbonochloridate has a molecular weight of 138.52 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroprop-2-enyl carbonochloridate is sourced from PubChem (CID 87314349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).