C17H24N2O8P2 — CID 87314735
[(2R)-1-[2-(5-methyl-1-oxo-2H-isoquinolin-3-yl)ethyl]pyrrolidin-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 87314735) has the molecular formula C17H24N2O8P2 and a molecular weight of 446.33 g/mol. Its IUPAC name is [(2R)-1-[2-(5-methyl-1-oxo-2H-isoquinolin-3-yl)ethyl]pyrrolidin-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R)-1-[2-(5-methyl-1-oxo-2H-isoquinolin-3-yl)ethyl]pyrrolidin-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87314735 |
| Molecular Formula | C17H24N2O8P2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [(2R)-1-[2-(5-methyl-1-oxo-2H-isoquinolin-3-yl)ethyl]pyrrolidin-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Cc1cccc2c(=O)[nH]c(CCN3CCC[C@@H]3COP(=O)(O)OP(=O)(O)O)cc12 |
| InChI | InChI=1S/C17H24N2O8P2/c1-12-4-2-6-15-16(12)10-13(18-17(15)20)7-9-19-8-3-5-14(19)11-26-29(24,25)27-28(21,22)23/h2,4,6,10,14H,3,5,7-9,11H2,1H3,(H,18,20)(H,24,25)(H2,21,22,23)/t14-/m1/s1 |
| InChIKey | FKRFRWZRTYSILC-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|