C20H25BrClNO8 — CID 87314867
[(2R,3R)-3-acetyloxy-1-[4-bromo-N-(2-chloroethyl)anilino]-4-tert-butylperoxy-1,4-dioxobutan-2-yl] acetate (PubChem CID 87314867) has the molecular formula C20H25BrClNO8 and a molecular weight of 522.78 g/mol. Its IUPAC name is [(2R,3R)-3-acetyloxy-1-[4-bromo-N-(2-chloroethyl)anilino]-4-tert-butylperoxy-1,4-dioxobutan-2-yl] acetate.
| Compound Name | [(2R,3R)-3-acetyloxy-1-[4-bromo-N-(2-chloroethyl)anilino]-4-tert-butylperoxy-1,4-dioxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 87314867 |
| Molecular Formula | C20H25BrClNO8 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | [(2R,3R)-3-acetyloxy-1-[4-bromo-N-(2-chloroethyl)anilino]-4-tert-butylperoxy-1,4-dioxobutan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)OOC(C)(C)C)[C@@H](OC(C)=O)C(=O)N(CCCl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H25BrClNO8/c1-12(24)28-16(17(29-13(2)25)19(27)30-31-20(3,4)5)18(26)23(11-10-22)15-8-6-14(21)7-9-15/h6-9,16-17H,10-11H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | CPCBZVNDTPWGFE-IAGOWNOFSA-N |
| XLogP | 3.16 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|