C24H27N3O8S3 — CID 87314983
1-[2-[2-carbamoyl-5-[1-(pyridin-2-yldisulfanyl)ethyl]phenyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 87314983) has the molecular formula C24H27N3O8S3 and a molecular weight of 581.69 g/mol. Its IUPAC name is 1-[2-[2-carbamoyl-5-[1-(pyridin-2-yldisulfanyl)ethyl]phenyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[2-[2-carbamoyl-5-[1-(pyridin-2-yldisulfanyl)ethyl]phenyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 87314983 |
| Molecular Formula | C24H27N3O8S3 |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | 1-[2-[2-carbamoyl-5-[1-(pyridin-2-yldisulfanyl)ethyl]phenyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | CCCCC(C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)c1cc(C(C)SSc2ccccn2)ccc1C(N)=O |
| InChI | InChI=1S/C24H27N3O8S3/c1-3-4-7-17(24(31)35-27-21(28)13-19(23(27)30)38(32,33)34)18-12-15(9-10-16(18)22(25)29)14(2)36-37-20-8-5-6-11-26-20/h5-6,8-12,14,17,19H,3-4,7,13H2,1-2H3,(H2,25,29)(H,32,33,34) |
| InChIKey | LTTQKXMPVRQLFN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|