About 1,1'-biphenyl;2-methyloxirane
1,1'-biphenyl;2-methyloxirane (PubChem CID 87315109) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,1'-biphenyl;2-methyloxirane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;2-methyloxirane |
| PubChem CID | 87315109 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1,1'-biphenyl;2-methyloxirane |
| SMILES | CC1CO1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2-4-3/h1-10H;3H,2H2,1H3 |
| InChIKey | JXTCVQBGTGMWOF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;2-methyloxirane?
The IUPAC name of 1,1'-biphenyl;2-methyloxirane (CID 87315109) is 1,1'-biphenyl;2-methyloxirane.
What is the SMILES notation for 1,1'-biphenyl;2-methyloxirane?
The canonical SMILES for 1,1'-biphenyl;2-methyloxirane is CC1CO1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;2-methyloxirane?
The InChIKey is JXTCVQBGTGMWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C3H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2-4-3/h1-10H;3H,2H2,1H3.
What are the key properties of 1,1'-biphenyl;2-methyloxirane?
1,1'-biphenyl;2-methyloxirane has a molecular weight of 212.29 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;2-methyloxirane is sourced from PubChem (CID 87315109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).