C22H19F17N2O2 — CID 87315434
4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-N,N-dimethyl-3-[methyl(propyl)amino]benzamide (PubChem CID 87315434) has the molecular formula C22H19F17N2O2 and a molecular weight of 666.37 g/mol. Its IUPAC name is 4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-N,N-dimethyl-3-[methyl(propyl)amino]benzamide.
| Compound Name | 4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-N,N-dimethyl-3-[methyl(propyl)amino]benzamide |
|---|---|
| PubChem CID | 87315434 |
| Molecular Formula | C22H19F17N2O2 |
| Molecular Weight | 666.37 g/mol |
| Exact Mass | 666.12 |
| IUPAC Name | 4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-N,N-dimethyl-3-[methyl(propyl)amino]benzamide |
| SMILES | CCCN(C)c1cc(C(=O)N(C)C)ccc1OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H19F17N2O2/c1-5-8-41(4)11-9-10(15(42)40(2)3)6-7-12(11)43-14(24)13(23)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)22(37,38)39/h6-7,9H,5,8H2,1-4H3 |
| InChIKey | WNAZQHAQTURSMM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.37 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|