C12H16F8O4S2 — CID 87315492
ethyl 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate (PubChem CID 87315492) has the molecular formula C12H16F8O4S2 and a molecular weight of 440.37 g/mol. Its IUPAC name is ethyl 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate.
| Compound Name | ethyl 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87315492 |
| Molecular Formula | C12H16F8O4S2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | ethyl 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(C)(CCSC(F)(F)F)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F8O4S2/c1-3-24-8(21)9(2,4-6-25-12(18,19)20)26(22,23)7-5-10(13,14)11(15,16)17/h3-7H2,1-2H3 |
| InChIKey | BVVAUZKGOUKDPF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|