C11H15F8NO3S2 — CID 87315722
N,2-dimethyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanamide (PubChem CID 87315722) has the molecular formula C11H15F8NO3S2 and a molecular weight of 425.36 g/mol. Its IUPAC name is N,2-dimethyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanamide.
| Compound Name | N,2-dimethyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanamide |
|---|---|
| PubChem CID | 87315722 |
| Molecular Formula | C11H15F8NO3S2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | N,2-dimethyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanamide |
| SMILES | CNC(=O)C(C)(CCSC(F)(F)F)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F8NO3S2/c1-8(7(21)20-2,3-5-24-11(17,18)19)25(22,23)6-4-9(12,13)10(14,15)16/h3-6H2,1-2H3,(H,20,21) |
| InChIKey | UREZBQHEYVQCRP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|