About 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane
1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane (PubChem CID 87315894) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane.
Molecular Properties
| Compound Name | 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane |
| PubChem CID | 87315894 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane |
| SMILES | C1CO1.C=COCC(COC=C)(COC=C)COC=C |
| InChI | InChI=1S/C13H20O4.C2H4O/c1-5-14-9-13(10-15-6-2,11-16-7-3)12-17-8-4;1-2-3-1/h5-8H,1-4,9-12H2;1-2H2 |
| InChIKey | VDCVMQLEPHJYHI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane?
The IUPAC name of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane (CID 87315894) is 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane.
What is the SMILES notation for 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane?
The canonical SMILES for 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane is C1CO1.C=COCC(COC=C)(COC=C)COC=C.
What is the InChIKey of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane?
The InChIKey is VDCVMQLEPHJYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4.C2H4O/c1-5-14-9-13(10-15-6-2,11-16-7-3)12-17-8-4;1-2-3-1/h5-8H,1-4,9-12H2;1-2H2.
What are the key properties of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane?
1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane has a molecular weight of 284.35 g/mol, XLogP of 2.63, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane;oxirane is sourced from PubChem (CID 87315894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).