C10H12F8O4S2 — CID 87315899
2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoic acid (PubChem CID 87315899) has the molecular formula C10H12F8O4S2 and a molecular weight of 412.32 g/mol. Its IUPAC name is 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoic acid.
| Compound Name | 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 87315899 |
| Molecular Formula | C10H12F8O4S2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoic acid |
| SMILES | CC(CCSC(F)(F)F)(C(=O)O)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F8O4S2/c1-7(6(19)20,2-4-23-10(16,17)18)24(21,22)5-3-8(11,12)9(13,14)15/h2-5H2,1H3,(H,19,20) |
| InChIKey | HUHOHYYRNQEVJO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|