C9H9F8NS2 — CID 87316255
2-(3,3,4,4,4-pentafluorobutylsulfanyl)-4-(trifluoromethylsulfanyl)butanenitrile (PubChem CID 87316255) has the molecular formula C9H9F8NS2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-(3,3,4,4,4-pentafluorobutylsulfanyl)-4-(trifluoromethylsulfanyl)butanenitrile.
| Compound Name | 2-(3,3,4,4,4-pentafluorobutylsulfanyl)-4-(trifluoromethylsulfanyl)butanenitrile |
|---|---|
| PubChem CID | 87316255 |
| Molecular Formula | C9H9F8NS2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-(3,3,4,4,4-pentafluorobutylsulfanyl)-4-(trifluoromethylsulfanyl)butanenitrile |
| SMILES | N#CC(CCSC(F)(F)F)SCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F8NS2/c10-7(11,8(12,13)14)2-4-19-6(5-18)1-3-20-9(15,16)17/h6H,1-4H2 |
| InChIKey | WJOIKXSCEUDINW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|