C24H20FNO4 — CID 8731678
[(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate (PubChem CID 8731678) has the molecular formula C24H20FNO4 and a molecular weight of 405.43 g/mol. Its IUPAC name is [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate.
| Compound Name | [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 8731678 |
| Molecular Formula | C24H20FNO4 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C(=O)c2ccccc2)cc1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FNO4/c1-16(23(28)26-15-17-7-13-21(25)14-8-17)30-24(29)20-11-9-19(10-12-20)22(27)18-5-3-2-4-6-18/h2-14,16H,15H2,1H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | BNMLPMHUXRMTGA-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |