About 1-chloro-3,5-dipentyl-2,4-dihydrotriazine
1-chloro-3,5-dipentyl-2,4-dihydrotriazine (PubChem CID 87316992) has the molecular formula C13H26ClN3
and a molecular weight of 259.82 g/mol. Its IUPAC name is 1-chloro-3,5-dipentyl-2,4-dihydrotriazine.
Molecular Properties
| Compound Name | 1-chloro-3,5-dipentyl-2,4-dihydrotriazine |
| PubChem CID | 87316992 |
| Molecular Formula | C13H26ClN3 |
| Molecular Weight | 259.82 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 1-chloro-3,5-dipentyl-2,4-dihydrotriazine |
| SMILES | CCCCCC1=CN(Cl)NN(CCCCC)C1 |
| InChI | InChI=1S/C13H26ClN3/c1-3-5-7-9-13-11-16(10-8-6-4-2)15-17(14)12-13/h12,15H,3-11H2,1-2H3 |
| InChIKey | USYZZIGGVDHNKR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3,5-dipentyl-2,4-dihydrotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,5-dipentyl-2,4-dihydrotriazine?
The IUPAC name of 1-chloro-3,5-dipentyl-2,4-dihydrotriazine (CID 87316992) is 1-chloro-3,5-dipentyl-2,4-dihydrotriazine.
What is the SMILES notation for 1-chloro-3,5-dipentyl-2,4-dihydrotriazine?
The canonical SMILES for 1-chloro-3,5-dipentyl-2,4-dihydrotriazine is CCCCCC1=CN(Cl)NN(CCCCC)C1.
What is the InChIKey of 1-chloro-3,5-dipentyl-2,4-dihydrotriazine?
The InChIKey is USYZZIGGVDHNKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26ClN3/c1-3-5-7-9-13-11-16(10-8-6-4-2)15-17(14)12-13/h12,15H,3-11H2,1-2H3.
What are the key properties of 1-chloro-3,5-dipentyl-2,4-dihydrotriazine?
1-chloro-3,5-dipentyl-2,4-dihydrotriazine has a molecular weight of 259.82 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,5-dipentyl-2,4-dihydrotriazine is sourced from PubChem (CID 87316992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).