About 3,4-dibromohexane-2,5-dione
3,4-dibromohexane-2,5-dione (PubChem CID 87317184) has the molecular formula C6H8Br2O2
and a molecular weight of 271.94 g/mol. Its IUPAC name is 3,4-dibromohexane-2,5-dione.
Molecular Properties
| Compound Name | 3,4-dibromohexane-2,5-dione |
| PubChem CID | 87317184 |
| Molecular Formula | C6H8Br2O2 |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 269.89 |
| IUPAC Name | 3,4-dibromohexane-2,5-dione |
| SMILES | CC(=O)C(Br)C(Br)C(C)=O |
| InChI | InChI=1S/C6H8Br2O2/c1-3(9)5(7)6(8)4(2)10/h5-6H,1-2H3 |
| InChIKey | CWSCJKDJTVWUMD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromohexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromohexane-2,5-dione?
The IUPAC name of 3,4-dibromohexane-2,5-dione (CID 87317184) is 3,4-dibromohexane-2,5-dione.
What is the SMILES notation for 3,4-dibromohexane-2,5-dione?
The canonical SMILES for 3,4-dibromohexane-2,5-dione is CC(=O)C(Br)C(Br)C(C)=O.
What is the InChIKey of 3,4-dibromohexane-2,5-dione?
The InChIKey is CWSCJKDJTVWUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Br2O2/c1-3(9)5(7)6(8)4(2)10/h5-6H,1-2H3.
What are the key properties of 3,4-dibromohexane-2,5-dione?
3,4-dibromohexane-2,5-dione has a molecular weight of 271.94 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromohexane-2,5-dione is sourced from PubChem (CID 87317184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).