C10H8N2 — CID 87317193
tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboximidamide (PubChem CID 87317193) has the molecular formula C10H8N2 and a molecular weight of 156.19 g/mol. Its IUPAC name is tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboximidamide.
| Compound Name | tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboximidamide |
|---|---|
| PubChem CID | 87317193 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CC=C2C1=CC1=CC12 |
| InChI | InChI=1S/C10H8N2/c11-10(12)7-2-1-6-8-3-5(8)4-9(6)7/h1-4,8H,(H3,11,12) |
| InChIKey | YUGBBDDNVVPPGV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|