About [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane
[2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane (PubChem CID 87317955) has the molecular formula C6H3F15S3
and a molecular weight of 456.26 g/mol. Its IUPAC name is [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane |
| PubChem CID | 87317955 |
| Molecular Formula | C6H3F15S3 |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 455.92 |
| IUPAC Name | [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)c1ccc(S(F)(F)(F)(F)F)c(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C6H3F15S3/c7-22(8,9,10,11)4-1-2-5(23(12,13,14,15)16)6(3-4)24(17,18,19,20)21/h1-3H |
| InChIKey | ZXVBGCMANBZADY-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane?
The IUPAC name of [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane (CID 87317955) is [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane.
What is the SMILES notation for [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane?
The canonical SMILES for [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane is FS(F)(F)(F)(F)c1ccc(S(F)(F)(F)(F)F)c(S(F)(F)(F)(F)F)c1.
What is the InChIKey of [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane?
The InChIKey is ZXVBGCMANBZADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F15S3/c7-22(8,9,10,11)4-1-2-5(23(12,13,14,15)16)6(3-4)24(17,18,19,20)21/h1-3H.
What are the key properties of [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane?
[2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane has a molecular weight of 456.26 g/mol, XLogP of 9.66, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(pentafluoro-λ6-sulfanyl)phenyl]-pentafluoro-λ6-sulfane is sourced from PubChem (CID 87317955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).