About ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid
ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid (PubChem CID 87318044) has the molecular formula C6H13O7P
and a molecular weight of 228.14 g/mol. Its IUPAC name is ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid.
Molecular Properties
| Compound Name | ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid |
| PubChem CID | 87318044 |
| Molecular Formula | C6H13O7P |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid |
| SMILES | C=C(CO)C(=O)OCC.O=P(O)(O)O |
| InChI | InChI=1S/C6H10O3.H3O4P/c1-3-9-6(8)5(2)4-7;1-5(2,3)4/h7H,2-4H2,1H3;(H3,1,2,3,4) |
| InChIKey | BUYWNICXSRDIFG-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid?
The IUPAC name of ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid (CID 87318044) is ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid.
What is the SMILES notation for ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid?
The canonical SMILES for ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid is C=C(CO)C(=O)OCC.O=P(O)(O)O.
What is the InChIKey of ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid?
The InChIKey is BUYWNICXSRDIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.H3O4P/c1-3-9-6(8)5(2)4-7;1-5(2,3)4/h7H,2-4H2,1H3;(H3,1,2,3,4).
What are the key properties of ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid?
ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid has a molecular weight of 228.14 g/mol, XLogP of -0.83, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(hydroxymethyl)prop-2-enoate;phosphoric acid is sourced from PubChem (CID 87318044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).