About (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate
(2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate (PubChem CID 87318333) has the molecular formula C12H15NO8S2
and a molecular weight of 365.39 g/mol. Its IUPAC name is (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate.
Molecular Properties
| Compound Name | (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate |
| PubChem CID | 87318333 |
| Molecular Formula | C12H15NO8S2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate |
| SMILES | CC(=O)SCC(=O)OC(=O)CC/C(=N/O)OC(=O)CSC(C)=O |
| InChI | InChI=1S/C12H15NO8S2/c1-7(14)22-5-11(17)20-9(13-19)3-4-10(16)21-12(18)6-23-8(2)15/h19H,3-6H2,1-2H3/b13-9- |
| InChIKey | OTOGAOSLEMINNS-LCYFTJDESA-N |
| XLogP | 0.73 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate?
The IUPAC name of (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate (CID 87318333) is (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate.
What is the SMILES notation for (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate?
The canonical SMILES for (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate is CC(=O)SCC(=O)OC(=O)CC/C(=N/O)OC(=O)CSC(C)=O.
What is the InChIKey of (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate?
The InChIKey is OTOGAOSLEMINNS-LCYFTJDESA-N. The full InChI is InChI=1S/C12H15NO8S2/c1-7(14)22-5-11(17)20-9(13-19)3-4-10(16)21-12(18)6-23-8(2)15/h19H,3-6H2,1-2H3/b13-9-.
What are the key properties of (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate?
(2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate has a molecular weight of 365.39 g/mol, XLogP of 0.73, 7 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylsulfanylacetyl) (4Z)-4-(2-acetylsulfanylacetyl)oxy-4-hydroxyiminobutanoate is sourced from PubChem (CID 87318333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).