About methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium
methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium (PubChem CID 87318490) has the molecular formula C10H28NO6SSi+
and a molecular weight of 318.49 g/mol. Its IUPAC name is methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium.
Molecular Properties
| Compound Name | methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium |
| PubChem CID | 87318490 |
| Molecular Formula | C10H28NO6SSi+ |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium |
| SMILES | CO[Si](CCC[N+](C)(C)C)(OC)OC.CS(=O)(=O)O |
| InChI | InChI=1S/C9H24NO3Si.CH4O3S/c1-10(2,3)8-7-9-14(11-4,12-5)13-6;1-5(2,3)4/h7-9H2,1-6H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | HUBDUUPCQYLZNG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium?
The IUPAC name of methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium (CID 87318490) is methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium.
What is the SMILES notation for methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium?
The canonical SMILES for methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium is CO[Si](CCC[N+](C)(C)C)(OC)OC.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium?
The InChIKey is HUBDUUPCQYLZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24NO3Si.CH4O3S/c1-10(2,3)8-7-9-14(11-4,12-5)13-6;1-5(2,3)4/h7-9H2,1-6H3;1H3,(H,2,3,4)/q+1;.
What are the key properties of methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium?
methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium has a molecular weight of 318.49 g/mol, XLogP of 0.46, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;trimethyl(3-trimethoxysilylpropyl)azanium is sourced from PubChem (CID 87318490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).