C19H24ClNO10S — CID 87318572
[(2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]-3,5-bis(ethoxycarbonyloxy)thian-4-yl] ethyl carbonate (PubChem CID 87318572) has the molecular formula C19H24ClNO10S and a molecular weight of 493.92 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]-3,5-bis(ethoxycarbonyloxy)thian-4-yl] ethyl carbonate.
| Compound Name | [(2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]-3,5-bis(ethoxycarbonyloxy)thian-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 87318572 |
| Molecular Formula | C19H24ClNO10S |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | [(2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]-3,5-bis(ethoxycarbonyloxy)thian-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CS[C@@H](Oc2cccnc2Cl)[C@H](OC(=O)OCC)[C@H]1OC(=O)OCC |
| InChI | InChI=1S/C19H24ClNO10S/c1-4-25-17(22)29-12-10-32-16(28-11-8-7-9-21-15(11)20)14(31-19(24)27-6-3)13(12)30-18(23)26-5-2/h7-9,12-14,16H,4-6,10H2,1-3H3/t12?,13-,14+,16+/m0/s1 |
| InChIKey | KCTDOMRSZOLZIZ-PMLFPYOBSA-N |
| XLogP | 3.81 |
| TPSA | 128.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|