C22H23ClFN3OS — CID 87318985
1-[[(2R,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-pentylsulfanyl-1,2,4-triazole (PubChem CID 87318985) has the molecular formula C22H23ClFN3OS and a molecular weight of 431.96 g/mol. Its IUPAC name is 1-[[(2R,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-pentylsulfanyl-1,2,4-triazole.
| Compound Name | 1-[[(2R,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-pentylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 87318985 |
| Molecular Formula | C22H23ClFN3OS |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 1-[[(2R,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-pentylsulfanyl-1,2,4-triazole |
| SMILES | CCCCCSc1ncnn1C[C@@]1(c2ccc(F)cc2)O[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C22H23ClFN3OS/c1-2-3-6-13-29-21-25-15-26-27(21)14-22(16-9-11-17(24)12-10-16)20(28-22)18-7-4-5-8-19(18)23/h4-5,7-12,15,20H,2-3,6,13-14H2,1H3/t20-,22-/m0/s1 |
| InChIKey | NDLFUCQFWMCMEW-UNMCSNQZSA-N |
| XLogP | 6.02 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|