C10F22O — CID 87319034
[1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)pentan-3-yl] hypofluorite (PubChem CID 87319034) has the molecular formula C10F22O and a molecular weight of 554.06 g/mol. Its IUPAC name is [1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)pentan-3-yl] hypofluorite.
| Compound Name | [1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)pentan-3-yl] hypofluorite |
|---|---|
| PubChem CID | 87319034 |
| Molecular Formula | C10F22O |
| Molecular Weight | 554.06 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | [1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-bis(trifluoromethyl)pentan-3-yl] hypofluorite |
| SMILES | FOC(C(F)(C(F)(F)F)C(F)(F)F)(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10F22O/c11-1(5(14,15)16,6(17,18)19)4(33-32,2(12,7(20,21)22)8(23,24)25)3(13,9(26,27)28)10(29,30)31 |
| InChIKey | RKFMQMQALIDOLV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.06 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |