C21H21ClFN3OS — CID 87319357
5-butylsulfanyl-1-[[(2R,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 87319357) has the molecular formula C21H21ClFN3OS and a molecular weight of 417.94 g/mol. Its IUPAC name is 5-butylsulfanyl-1-[[(2R,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 5-butylsulfanyl-1-[[(2R,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 87319357 |
| Molecular Formula | C21H21ClFN3OS |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 5-butylsulfanyl-1-[[(2R,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | CCCCSc1ncnn1C[C@@]1(c2ccc(F)cc2)O[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C21H21ClFN3OS/c1-2-3-12-28-20-24-14-25-26(20)13-21(15-8-10-16(23)11-9-15)19(27-21)17-6-4-5-7-18(17)22/h4-11,14,19H,2-3,12-13H2,1H3/t19-,21+/m1/s1 |
| InChIKey | RKLXCHGRRBLQMO-CTNGQTDRSA-N |
| XLogP | 5.63 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|