C9H14F3N3O4 — CID 87319478
2-[2-[(2,2,2-trifluoroacetyl)amino]butanoylamino]ethylcarbamic acid (PubChem CID 87319478) has the molecular formula C9H14F3N3O4 and a molecular weight of 285.22 g/mol. Its IUPAC name is 2-[2-[(2,2,2-trifluoroacetyl)amino]butanoylamino]ethylcarbamic acid.
| Compound Name | 2-[2-[(2,2,2-trifluoroacetyl)amino]butanoylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 87319478 |
| Molecular Formula | C9H14F3N3O4 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[2-[(2,2,2-trifluoroacetyl)amino]butanoylamino]ethylcarbamic acid |
| SMILES | CCC(NC(=O)C(F)(F)F)C(=O)NCCNC(=O)O |
| InChI | InChI=1S/C9H14F3N3O4/c1-2-5(15-7(17)9(10,11)12)6(16)13-3-4-14-8(18)19/h5,14H,2-4H2,1H3,(H,13,16)(H,15,17)(H,18,19) |
| InChIKey | PHBATXBMWKGSHA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|